C14H13BrF3NO — CID 107332986
2-[4-bromo-2-(trifluoromethyl)benzoyl]-4-methylpentanenitrile (PubChem CID 107332986) has the molecular formula C14H13BrF3NO and a molecular weight of 348.16 g/mol. Its IUPAC name is 2-[4-bromo-2-(trifluoromethyl)benzoyl]-4-methylpentanenitrile.
| Compound Name | 2-[4-bromo-2-(trifluoromethyl)benzoyl]-4-methylpentanenitrile |
|---|---|
| PubChem CID | 107332986 |
| Molecular Formula | C14H13BrF3NO |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 2-[4-bromo-2-(trifluoromethyl)benzoyl]-4-methylpentanenitrile |
| SMILES | CC(C)CC(C#N)C(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H13BrF3NO/c1-8(2)5-9(7-19)13(20)11-4-3-10(15)6-12(11)14(16,17)18/h3-4,6,8-9H,5H2,1-2H3 |
| InChIKey | RRYCPVWWPADNAB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|