C23H20N4O5 — CID 155431429
N-[4-(hydroxycarbamoyl)phenyl]-4-(4-methoxyphenyl)-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 155431429) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is N-[4-(hydroxycarbamoyl)phenyl]-4-(4-methoxyphenyl)-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[4-(hydroxycarbamoyl)phenyl]-4-(4-methoxyphenyl)-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155431429 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[4-(hydroxycarbamoyl)phenyl]-4-(4-methoxyphenyl)-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | COc1ccc(-c2cn(C)c(=O)c3[nH]c(C(=O)Nc4ccc(C(=O)NO)cc4)cc23)cc1 |
| InChI | InChI=1S/C23H20N4O5/c1-27-12-18(13-5-9-16(32-2)10-6-13)17-11-19(25-20(17)23(27)30)22(29)24-15-7-3-14(4-8-15)21(28)26-31/h3-12,25,31H,1-2H3,(H,24,29)(H,26,28) |
| InChIKey | AKDWGKDZPGUISH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 125.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|