C7H9N3O3S — CID 155432044
methyl 3-(aminosulfonimidoyl)pyridine-2-carboxylate (PubChem CID 155432044) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is methyl 3-(aminosulfonimidoyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-(aminosulfonimidoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 155432044 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | methyl 3-(aminosulfonimidoyl)pyridine-2-carboxylate |
| SMILES | [H]N=S(N)(=O)c1cccnc1C(=O)OC |
| InChI | InChI=1S/C7H9N3O3S/c1-13-7(11)6-5(14(8,9)12)3-2-4-10-6/h2-4H,1H3,(H3,8,9,12) |
| InChIKey | UGTXITMCGGUTOC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |