C11H11N3O4S2 — CID 65427405
methyl 3-[(2-amino-3-pyridinyl)sulfonylamino]thiophene-2-carboxylate (PubChem CID 65427405) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 3-[(2-amino-3-pyridinyl)sulfonylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-amino-3-pyridinyl)sulfonylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 65427405 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | methyl 3-[(2-amino-3-pyridinyl)sulfonylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NS(=O)(=O)c1cccnc1N |
| InChI | InChI=1S/C11H11N3O4S2/c1-18-11(15)9-7(4-6-19-9)14-20(16,17)8-3-2-5-13-10(8)12/h2-6,14H,1H3,(H2,12,13) |
| InChIKey | SSJTUIRNKMWZAT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |