C54H64ClN3 — CID 155433420
3,5-bis(4a,9a-dimethyl-1,2,3,4-tetrahydrocarbazol-9-yl)-N,N-bis(4-tert-butylphenyl)-4-chloroaniline (PubChem CID 155433420) has the molecular formula C54H64ClN3 and a molecular weight of 790.58 g/mol. Its IUPAC name is 3,5-bis(4a,9a-dimethyl-1,2,3,4-tetrahydrocarbazol-9-yl)-N,N-bis(4-tert-butylphenyl)-4-chloroaniline.
| Compound Name | 3,5-bis(4a,9a-dimethyl-1,2,3,4-tetrahydrocarbazol-9-yl)-N,N-bis(4-tert-butylphenyl)-4-chloroaniline |
|---|---|
| PubChem CID | 155433420 |
| Molecular Formula | C54H64ClN3 |
| Molecular Weight | 790.58 g/mol |
| Exact Mass | 789.48 |
| IUPAC Name | 3,5-bis(4a,9a-dimethyl-1,2,3,4-tetrahydrocarbazol-9-yl)-N,N-bis(4-tert-butylphenyl)-4-chloroaniline |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(N3c4ccccc4C4(C)CCCCC34C)c(Cl)c(N3c4ccccc4C4(C)CCCCC34C)c2)cc1 |
| InChI | InChI=1S/C54H64ClN3/c1-49(2,3)37-23-27-39(28-24-37)56(40-29-25-38(26-30-40)50(4,5)6)41-35-46(57-44-21-13-11-19-42(44)51(7)31-15-17-33-53(51,57)9)48(55)47(36-41)58-45-22-14-12-20-43(45)52(8)32-16-18-34-54(52,58)10/h11-14,19-30,35-36H,15-18,31-34H2,1-10H3 |
| InChIKey | YYVGIHZFUURXRE-UHFFFAOYSA-N |
| XLogP | 15.89 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.58 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |