C47H54N2 — CID 166015021
3-(4a,9a-dimethyl-6-phenyl-1,2,3,4-tetrahydrocarbazol-9-yl)-N,N-bis(4-tert-butylphenyl)-5-methylaniline (PubChem CID 166015021) has the molecular formula C47H54N2 and a molecular weight of 646.96 g/mol. Its IUPAC name is 3-(4a,9a-dimethyl-6-phenyl-1,2,3,4-tetrahydrocarbazol-9-yl)-N,N-bis(4-tert-butylphenyl)-5-methylaniline.
| Compound Name | 3-(4a,9a-dimethyl-6-phenyl-1,2,3,4-tetrahydrocarbazol-9-yl)-N,N-bis(4-tert-butylphenyl)-5-methylaniline |
|---|---|
| PubChem CID | 166015021 |
| Molecular Formula | C47H54N2 |
| Molecular Weight | 646.96 g/mol |
| Exact Mass | 646.43 |
| IUPAC Name | 3-(4a,9a-dimethyl-6-phenyl-1,2,3,4-tetrahydrocarbazol-9-yl)-N,N-bis(4-tert-butylphenyl)-5-methylaniline |
| SMILES | Cc1cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc(N2c3ccc(-c4ccccc4)cc3C3(C)CCCCC23C)c1 |
| InChI | InChI=1S/C47H54N2/c1-33-29-40(48(38-22-18-36(19-23-38)44(2,3)4)39-24-20-37(21-25-39)45(5,6)7)32-41(30-33)49-43-26-17-35(34-15-11-10-12-16-34)31-42(43)46(8)27-13-14-28-47(46,49)9/h10-12,15-26,29-32H,13-14,27-28H2,1-9H3 |
| InChIKey | VVCWCBWJXNWZSL-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.96 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |