C19H17Cl2FN2O2 — CID 155433548
(5S,8S)-N-[1-(2,4-dichlorophenyl)ethyl]-5-fluorospiro[6,7-dihydroquinoline-8,2'-oxirane]-5-carboxamide (PubChem CID 155433548) has the molecular formula C19H17Cl2FN2O2 and a molecular weight of 395.26 g/mol. Its IUPAC name is (5S,8S)-N-[1-(2,4-dichlorophenyl)ethyl]-5-fluorospiro[6,7-dihydroquinoline-8,2'-oxirane]-5-carboxamide.
| Compound Name | (5S,8S)-N-[1-(2,4-dichlorophenyl)ethyl]-5-fluorospiro[6,7-dihydroquinoline-8,2'-oxirane]-5-carboxamide |
|---|---|
| PubChem CID | 155433548 |
| Molecular Formula | C19H17Cl2FN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (5S,8S)-N-[1-(2,4-dichlorophenyl)ethyl]-5-fluorospiro[6,7-dihydroquinoline-8,2'-oxirane]-5-carboxamide |
| SMILES | CC(NC(=O)[C@]1(F)CC[C@@]2(CO2)c2ncccc21)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2FN2O2/c1-11(13-5-4-12(20)9-15(13)21)24-17(25)19(22)7-6-18(10-26-18)16-14(19)3-2-8-23-16/h2-5,8-9,11H,6-7,10H2,1H3,(H,24,25)/t11?,18-,19+/m1/s1 |
| InChIKey | LCQRANNYIQEPIB-VEQZCADJSA-N |
| XLogP | 4.45 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|