C18H15Cl2FN2O2 — CID 155454214
(5R,8S)-N-[(2,4-dichlorophenyl)methyl]-5-fluorospiro[6,7-dihydroquinoline-8,2'-oxirane]-5-carboxamide (PubChem CID 155454214) has the molecular formula C18H15Cl2FN2O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is (5R,8S)-N-[(2,4-dichlorophenyl)methyl]-5-fluorospiro[6,7-dihydroquinoline-8,2'-oxirane]-5-carboxamide.
| Compound Name | (5R,8S)-N-[(2,4-dichlorophenyl)methyl]-5-fluorospiro[6,7-dihydroquinoline-8,2'-oxirane]-5-carboxamide |
|---|---|
| PubChem CID | 155454214 |
| Molecular Formula | C18H15Cl2FN2O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (5R,8S)-N-[(2,4-dichlorophenyl)methyl]-5-fluorospiro[6,7-dihydroquinoline-8,2'-oxirane]-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)[C@@]1(F)CC[C@@]2(CO2)c2ncccc21 |
| InChI | InChI=1S/C18H15Cl2FN2O2/c19-12-4-3-11(14(20)8-12)9-23-16(24)18(21)6-5-17(10-25-17)15-13(18)2-1-7-22-15/h1-4,7-8H,5-6,9-10H2,(H,23,24)/t17-,18-/m1/s1 |
| InChIKey | YDQWQHBZRMWYPI-QZTJIDSGSA-N |
| XLogP | 3.89 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|