C14H16BrN3 — CID 155435209
3-[(3-bromophenyl)-cyclobutylmethyl]-4-methyl-1,2,4-triazole (PubChem CID 155435209) has the molecular formula C14H16BrN3 and a molecular weight of 306.21 g/mol. Its IUPAC name is 3-[(3-bromophenyl)-cyclobutylmethyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[(3-bromophenyl)-cyclobutylmethyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 155435209 |
| Molecular Formula | C14H16BrN3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-[(3-bromophenyl)-cyclobutylmethyl]-4-methyl-1,2,4-triazole |
| SMILES | Cn1cnnc1C(c1cccc(Br)c1)C1CCC1 |
| InChI | InChI=1S/C14H16BrN3/c1-18-9-16-17-14(18)13(10-4-2-5-10)11-6-3-7-12(15)8-11/h3,6-10,13H,2,4-5H2,1H3 |
| InChIKey | RFHYNDDHSALQGX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |