C16H22N4O2 — CID 178119708
3-[cyclobutyl-(3-nitrophenyl)methyl]-4-methyl-1,2,4-triazole;ethane (PubChem CID 178119708) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[cyclobutyl-(3-nitrophenyl)methyl]-4-methyl-1,2,4-triazole;ethane.
| Compound Name | 3-[cyclobutyl-(3-nitrophenyl)methyl]-4-methyl-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 178119708 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-[cyclobutyl-(3-nitrophenyl)methyl]-4-methyl-1,2,4-triazole;ethane |
| SMILES | CC.Cn1cnnc1C(c1cccc([N+](=O)[O-])c1)C1CCC1 |
| InChI | InChI=1S/C14H16N4O2.C2H6/c1-17-9-15-16-14(17)13(10-4-2-5-10)11-6-3-7-12(8-11)18(19)20;1-2/h3,6-10,13H,2,4-5H2,1H3;1-2H3 |
| InChIKey | LAJMRFMMIJDZMK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|