C18H21N5O3 — CID 171752875
(E)-3-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitrophenyl]-N-methylprop-2-enamide (PubChem CID 171752875) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is (E)-3-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitrophenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitrophenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 171752875 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (E)-3-[3-[cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitrophenyl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1cc(C(c2nncn2C)C2CCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H21N5O3/c1-19-16(24)7-6-12-8-14(10-15(9-12)23(25)26)17(13-4-3-5-13)18-21-20-11-22(18)2/h6-11,13,17H,3-5H2,1-2H3,(H,19,24)/b7-6+ |
| InChIKey | VWWJGVJDJIKRRD-VOTSOKGWSA-N |
| XLogP | 2.41 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|