C19H25N3O4 — CID 155438157
methyl 4-(6-amino-5-morpholin-4-yl-1,3-benzoxazol-2-yl)cyclohexane-1-carboxylate (PubChem CID 155438157) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl 4-(6-amino-5-morpholin-4-yl-1,3-benzoxazol-2-yl)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(6-amino-5-morpholin-4-yl-1,3-benzoxazol-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155438157 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | methyl 4-(6-amino-5-morpholin-4-yl-1,3-benzoxazol-2-yl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(c2nc3cc(N4CCOCC4)c(N)cc3o2)CC1 |
| InChI | InChI=1S/C19H25N3O4/c1-24-19(23)13-4-2-12(3-5-13)18-21-15-11-16(14(20)10-17(15)26-18)22-6-8-25-9-7-22/h10-13H,2-9,20H2,1H3 |
| InChIKey | JVMPNQFTAYHERC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|