C22H31F2N5O2 — CID 155441607
N-[(5Z)-5-(5-butan-2-yl-1,2,4-triazol-1-yl)-7-(difluoromethyl)-3-methyl-4-[(3-methyl-1,2-oxazol-5-yl)methyl]octa-5,7-dienyl]formamide (PubChem CID 155441607) has the molecular formula C22H31F2N5O2 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[(5Z)-5-(5-butan-2-yl-1,2,4-triazol-1-yl)-7-(difluoromethyl)-3-methyl-4-[(3-methyl-1,2-oxazol-5-yl)methyl]octa-5,7-dienyl]formamide.
| Compound Name | N-[(5Z)-5-(5-butan-2-yl-1,2,4-triazol-1-yl)-7-(difluoromethyl)-3-methyl-4-[(3-methyl-1,2-oxazol-5-yl)methyl]octa-5,7-dienyl]formamide |
|---|---|
| PubChem CID | 155441607 |
| Molecular Formula | C22H31F2N5O2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-[(5Z)-5-(5-butan-2-yl-1,2,4-triazol-1-yl)-7-(difluoromethyl)-3-methyl-4-[(3-methyl-1,2-oxazol-5-yl)methyl]octa-5,7-dienyl]formamide |
| SMILES | C=C(/C=C(/C(Cc1cc(C)no1)C(C)CCNC=O)n1ncnc1C(C)CC)C(F)F |
| InChI | InChI=1S/C22H31F2N5O2/c1-6-14(2)22-26-12-27-29(22)20(9-16(4)21(23)24)19(15(3)7-8-25-13-30)11-18-10-17(5)28-31-18/h9-10,12-15,19,21H,4,6-8,11H2,1-3,5H3,(H,25,30)/b20-9- |
| InChIKey | WNXMAOSAFYOLFD-UKWGHVSLSA-N |
| XLogP | 4.38 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|