C20H25NO2 — CID 155444836
(2R)-N,N-dibenzyl-5-hydroxy-2-methylpentanamide (PubChem CID 155444836) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (2R)-N,N-dibenzyl-5-hydroxy-2-methylpentanamide.
| Compound Name | (2R)-N,N-dibenzyl-5-hydroxy-2-methylpentanamide |
|---|---|
| PubChem CID | 155444836 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (2R)-N,N-dibenzyl-5-hydroxy-2-methylpentanamide |
| SMILES | C[C@H](CCCO)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H25NO2/c1-17(9-8-14-22)20(23)21(15-18-10-4-2-5-11-18)16-19-12-6-3-7-13-19/h2-7,10-13,17,22H,8-9,14-16H2,1H3/t17-/m1/s1 |
| InChIKey | KAAFNWXOVBFZOG-QGZVFWFLSA-N |
| XLogP | 3.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |