C33H21ClN4 — CID 155445890
9-[4-(4-chlorophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]carbazole (PubChem CID 155445890) has the molecular formula C33H21ClN4 and a molecular weight of 509.01 g/mol. Its IUPAC name is 9-[4-(4-chlorophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-(4-chlorophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 155445890 |
| Molecular Formula | C33H21ClN4 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 9-[4-(4-chlorophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]carbazole |
| SMILES | Clc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-n3c4ccccc4c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C33H21ClN4/c34-26-20-18-25(19-21-26)32-35-31(24-16-14-23(15-17-24)22-8-2-1-3-9-22)36-33(37-32)38-29-12-6-4-10-27(29)28-11-5-7-13-30(28)38/h1-21H |
| InChIKey | YTCHEFKRNKJPSH-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |