C16H12N4 — CID 155445897
3-(5-methyl-1H-pyrazol-4-yl)-1,10-phenanthroline (PubChem CID 155445897) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-(5-methyl-1H-pyrazol-4-yl)-1,10-phenanthroline.
| Compound Name | 3-(5-methyl-1H-pyrazol-4-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 155445897 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-(5-methyl-1H-pyrazol-4-yl)-1,10-phenanthroline |
| SMILES | Cc1[nH]ncc1-c1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C16H12N4/c1-10-14(9-19-20-10)13-7-12-5-4-11-3-2-6-17-15(11)16(12)18-8-13/h2-9H,1H3,(H,19,20) |
| InChIKey | QBEUAWASRLASAW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|