C21H24N4O3 — CID 155445972
tert-butyl 7-benzyl-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-12-carboxylate (PubChem CID 155445972) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is tert-butyl 7-benzyl-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-12-carboxylate.
| Compound Name | tert-butyl 7-benzyl-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 155445972 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | tert-butyl 7-benzyl-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(n3nccc3n(Cc3ccccc3)c2=O)C1 |
| InChI | InChI=1S/C21H24N4O3/c1-21(2,3)28-20(27)23-12-10-16-17(14-23)25-18(9-11-22-25)24(19(16)26)13-15-7-5-4-6-8-15/h4-9,11H,10,12-14H2,1-3H3 |
| InChIKey | TZSSJPBIYLXFJY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |