C56H36F6N4 — CID 155447368
5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-12,12-dimethylindeno[1,2-c]carbazole (PubChem CID 155447368) has the molecular formula C56H36F6N4 and a molecular weight of 878.92 g/mol. Its IUPAC name is 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-12,12-dimethylindeno[1,2-c]carbazole.
| Compound Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-12,12-dimethylindeno[1,2-c]carbazole |
|---|---|
| PubChem CID | 155447368 |
| Molecular Formula | C56H36F6N4 |
| Molecular Weight | 878.92 g/mol |
| Exact Mass | 878.28 |
| IUPAC Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-12,12-dimethylindeno[1,2-c]carbazole |
| SMILES | CC1(C)c2ccccc2-c2ccc3c(c21)c1ccccc1n3-c1c(-c2ccccc2C(F)(F)F)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C56H36F6N4/c1-54(2)43-25-13-9-21-36(43)39-29-30-47-48(49(39)54)40-24-12-16-28-46(40)66(47)50-41(37-22-10-14-26-44(37)55(57,58)59)31-35(32-42(50)38-23-11-15-27-45(38)56(60,61)62)53-64-51(33-17-5-3-6-18-33)63-52(65-53)34-19-7-4-8-20-34/h3-32H,1-2H3 |
| InChIKey | BABCUFHJNOAKIG-UHFFFAOYSA-N |
| XLogP | 15.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.92 |
| LogP ≤ 5 | 15.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |