C23H25Cl2N7 — CID 155447901
(3R,4R)-8-[12-(2,3-dichlorophenyl)-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-methyl-8-azaspiro[4.5]decan-4-amine (PubChem CID 155447901) has the molecular formula C23H25Cl2N7 and a molecular weight of 470.41 g/mol. Its IUPAC name is (3R,4R)-8-[12-(2,3-dichlorophenyl)-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-methyl-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (3R,4R)-8-[12-(2,3-dichlorophenyl)-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-methyl-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 155447901 |
| Molecular Formula | C23H25Cl2N7 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (3R,4R)-8-[12-(2,3-dichlorophenyl)-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-methyl-8-azaspiro[4.5]decan-4-amine |
| SMILES | C[C@@H]1CCC2(CCN(c3nc4n[nH]c(-c5cccc(Cl)c5Cl)c4c4nccn34)CC2)[C@@H]1N |
| InChI | InChI=1S/C23H25Cl2N7/c1-13-5-6-23(19(13)26)7-10-31(11-8-23)22-28-20-16(21-27-9-12-32(21)22)18(29-30-20)14-3-2-4-15(24)17(14)25/h2-4,9,12-13,19H,5-8,10-11,26H2,1H3,(H,29,30)/t13-,19-/m1/s1 |
| InChIKey | WXWAFTHHNPILSG-BFUOFWGJSA-N |
| XLogP | 4.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |