C24H30N4O2 — CID 155448898
N-[2-(4-ethylcyclohexyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]pyridine-2-carboxamide (PubChem CID 155448898) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[2-(4-ethylcyclohexyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]pyridine-2-carboxamide.
| Compound Name | N-[2-(4-ethylcyclohexyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155448898 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[2-(4-ethylcyclohexyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]pyridine-2-carboxamide |
| SMILES | CCC1CCC(n2cc3cc(NC(=O)c4ccccn4)c(C(C)(C)O)cc3n2)CC1 |
| InChI | InChI=1S/C24H30N4O2/c1-4-16-8-10-18(11-9-16)28-15-17-13-22(19(24(2,3)30)14-21(17)27-28)26-23(29)20-7-5-6-12-25-20/h5-7,12-16,18,30H,4,8-11H2,1-3H3,(H,26,29) |
| InChIKey | QRDUGLAFTOCHBF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |