C24H28N4O4 — CID 155437843
N-[2-(4-formylcyclohexyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]-6-methoxypyridine-2-carboxamide (PubChem CID 155437843) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[2-(4-formylcyclohexyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]-6-methoxypyridine-2-carboxamide.
| Compound Name | N-[2-(4-formylcyclohexyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]-6-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 155437843 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[2-(4-formylcyclohexyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]-6-methoxypyridine-2-carboxamide |
| SMILES | COc1cccc(C(=O)Nc2cc3cn(C4CCC(C=O)CC4)nc3cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C24H28N4O4/c1-24(2,31)18-12-20-16(13-28(27-20)17-9-7-15(14-29)8-10-17)11-21(18)26-23(30)19-5-4-6-22(25-19)32-3/h4-6,11-15,17,31H,7-10H2,1-3H3,(H,26,30) |
| InChIKey | UXWVMFPQSUFUAL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|