C16H33F2NO — CID 155451069
3,3-difluoro-4-(5-methylundecan-5-ylamino)butan-1-ol (PubChem CID 155451069) has the molecular formula C16H33F2NO and a molecular weight of 293.44 g/mol. Its IUPAC name is 3,3-difluoro-4-(5-methylundecan-5-ylamino)butan-1-ol.
| Compound Name | 3,3-difluoro-4-(5-methylundecan-5-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 155451069 |
| Molecular Formula | C16H33F2NO |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 3,3-difluoro-4-(5-methylundecan-5-ylamino)butan-1-ol |
| SMILES | CCCCCCC(C)(CCCC)NCC(F)(F)CCO |
| InChI | InChI=1S/C16H33F2NO/c1-4-6-8-9-11-15(3,10-7-5-2)19-14-16(17,18)12-13-20/h19-20H,4-14H2,1-3H3 |
| InChIKey | NSZVRSZCTWHDAK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|