C31H52O7 — CID 155454208
(4R)-4-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 155454208) has the molecular formula C31H52O7 and a molecular weight of 536.75 g/mol. Its IUPAC name is (4R)-4-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 155454208 |
| Molecular Formula | C31H52O7 |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | (4R)-4-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | COCCOCCOCC(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCC(=O)O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H52O7/c1-21(5-10-28(32)33)25-8-9-26-24-7-6-22-19-23(38-29(34)20-37-18-17-36-16-15-35-4)11-13-30(22,2)27(24)12-14-31(25,26)3/h21-27H,5-20H2,1-4H3,(H,32,33)/t21-,22-,23+,24+,25-,26+,27+,30+,31-/m1/s1 |
| InChIKey | VJSAQMADFCQAMK-NKFUBTFUSA-N |
| XLogP | 5.74 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|