C11H18O4 — CID 15545519
methyl (2R,3R,5S)-2,3,5-trimethyl-5-(2-oxoethyl)oxolane-2-carboxylate (PubChem CID 15545519) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl (2R,3R,5S)-2,3,5-trimethyl-5-(2-oxoethyl)oxolane-2-carboxylate.
| Compound Name | methyl (2R,3R,5S)-2,3,5-trimethyl-5-(2-oxoethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 15545519 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | methyl (2R,3R,5S)-2,3,5-trimethyl-5-(2-oxoethyl)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@]1(C)O[C@](C)(CC=O)C[C@H]1C |
| InChI | InChI=1S/C11H18O4/c1-8-7-10(2,5-6-12)15-11(8,3)9(13)14-4/h6,8H,5,7H2,1-4H3/t8-,10-,11-/m1/s1 |
| InChIKey | IXBYKGQFZFUQMY-FBIMIBRVSA-N |
| XLogP | 1.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|