C14H22O7 — CID 163023814
methyl 5-acetyloxy-2-(1-methoxyethyl)-4,5-dimethyl-6-oxooxane-2-carboxylate (PubChem CID 163023814) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is methyl 5-acetyloxy-2-(1-methoxyethyl)-4,5-dimethyl-6-oxooxane-2-carboxylate.
| Compound Name | methyl 5-acetyloxy-2-(1-methoxyethyl)-4,5-dimethyl-6-oxooxane-2-carboxylate |
|---|---|
| PubChem CID | 163023814 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | methyl 5-acetyloxy-2-(1-methoxyethyl)-4,5-dimethyl-6-oxooxane-2-carboxylate |
| SMILES | COC(=O)C1(C(C)OC)CC(C)C(C)(OC(C)=O)C(=O)O1 |
| InChI | InChI=1S/C14H22O7/c1-8-7-14(9(2)18-5,12(17)19-6)21-11(16)13(8,4)20-10(3)15/h8-9H,7H2,1-6H3 |
| InChIKey | LOSPKFCLBIRZGS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|