C14H20O7 — CID 102529609
trimethyl (3S,3aR,7aS)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1,1,3-tricarboxylate (PubChem CID 102529609) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is trimethyl (3S,3aR,7aS)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1,1,3-tricarboxylate.
| Compound Name | trimethyl (3S,3aR,7aS)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 102529609 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | trimethyl (3S,3aR,7aS)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1,1,3-tricarboxylate |
| SMILES | COC(=O)[C@H]1OC(C(=O)OC)(C(=O)OC)[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C14H20O7/c1-18-11(15)10-8-6-4-5-7-9(8)14(21-10,12(16)19-2)13(17)20-3/h8-10H,4-7H2,1-3H3/t8-,9+,10+/m1/s1 |
| InChIKey | MICDHGRFYDRKLP-UTLUCORTSA-N |
| XLogP | 0.45 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|