C19H26O11 — CID 91250476
methyl 6-methyl-2-oxo-4-(1,2,3-triacetyloxypropyl)-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate (PubChem CID 91250476) has the molecular formula C19H26O11 and a molecular weight of 430.41 g/mol. Its IUPAC name is methyl 6-methyl-2-oxo-4-(1,2,3-triacetyloxypropyl)-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate.
| Compound Name | methyl 6-methyl-2-oxo-4-(1,2,3-triacetyloxypropyl)-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 91250476 |
| Molecular Formula | C19H26O11 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | methyl 6-methyl-2-oxo-4-(1,2,3-triacetyloxypropyl)-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
| SMILES | COC(=O)C1(C)CC2OC(=O)CC2C(C(OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C19H26O11/c1-9(20)26-8-14(27-10(2)21)17(28-11(3)22)16-12-6-15(23)29-13(12)7-19(4,30-16)18(24)25-5/h12-14,16-17H,6-8H2,1-5H3 |
| InChIKey | ZYMCNPQFVIJVDT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|