C11H20O5 — CID 54008038
methyl (3S)-4,5-dimethoxy-3,6-dimethyloxane-2-carboxylate (PubChem CID 54008038) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (3S)-4,5-dimethoxy-3,6-dimethyloxane-2-carboxylate.
| Compound Name | methyl (3S)-4,5-dimethoxy-3,6-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 54008038 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | methyl (3S)-4,5-dimethoxy-3,6-dimethyloxane-2-carboxylate |
| SMILES | COC(=O)C1OC(C)C(OC)C(OC)[C@@H]1C |
| InChI | InChI=1S/C11H20O5/c1-6-8(13-3)10(14-4)7(2)16-9(6)11(12)15-5/h6-10H,1-5H3/t6-,7?,8?,9?,10?/m0/s1 |
| InChIKey | AAFMBOQCWNYQBN-FGPZPYONSA-N |
| XLogP | 0.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |