C19H26F2O11 — CID 91193405
methyl 4-acetyloxy-2,3-difluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate (PubChem CID 91193405) has the molecular formula C19H26F2O11 and a molecular weight of 468.40 g/mol. Its IUPAC name is methyl 4-acetyloxy-2,3-difluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate.
| Compound Name | methyl 4-acetyloxy-2,3-difluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91193405 |
| Molecular Formula | C19H26F2O11 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | methyl 4-acetyloxy-2,3-difluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(F)OC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)C(C)C(OC(C)=O)C1F |
| InChI | InChI=1S/C19H26F2O11/c1-8-14(16(31-12(5)25)13(29-10(3)23)7-28-9(2)22)32-19(21,18(26)27-6)17(20)15(8)30-11(4)24/h8,13-17H,7H2,1-6H3 |
| InChIKey | NXZDRTCCHMHWKS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|