C21H28FNO12 — CID 91556836
methyl 2-acetyloxy-4-(cyanomethoxy)-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate (PubChem CID 91556836) has the molecular formula C21H28FNO12 and a molecular weight of 505.45 g/mol. Its IUPAC name is methyl 2-acetyloxy-4-(cyanomethoxy)-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate.
| Compound Name | methyl 2-acetyloxy-4-(cyanomethoxy)-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91556836 |
| Molecular Formula | C21H28FNO12 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | methyl 2-acetyloxy-4-(cyanomethoxy)-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(OC(C)=O)OC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)C(C)C(OCC#N)C1F |
| InChI | InChI=1S/C21H28FNO12/c1-10-16(18(33-13(4)26)15(32-12(3)25)9-31-11(2)24)35-21(20(28)29-6,34-14(5)27)19(22)17(10)30-8-7-23/h10,15-19H,8-9H2,1-6H3 |
| InChIKey | HYHNXRPIOCDQDT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 173.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|