C19H25F2NO10 — CID 91159713
methyl 4-(cyanomethoxy)-2,3-difluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate (PubChem CID 91159713) has the molecular formula C19H25F2NO10 and a molecular weight of 465.40 g/mol. Its IUPAC name is methyl 4-(cyanomethoxy)-2,3-difluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate.
| Compound Name | methyl 4-(cyanomethoxy)-2,3-difluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91159713 |
| Molecular Formula | C19H25F2NO10 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | methyl 4-(cyanomethoxy)-2,3-difluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(F)OC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)C(C)C(OCC#N)C1F |
| InChI | InChI=1S/C19H25F2NO10/c1-9-14(16(31-12(4)25)13(30-11(3)24)8-29-10(2)23)32-19(21,18(26)27-5)17(20)15(9)28-7-6-22/h9,13-17H,7-8H2,1-5H3 |
| InChIKey | LAVGNPQRULGEII-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 147.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|