C19H27FO11 — CID 91589603
methyl 2-acetyloxy-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate (PubChem CID 91589603) has the molecular formula C19H27FO11 and a molecular weight of 450.41 g/mol. Its IUPAC name is methyl 2-acetyloxy-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate.
| Compound Name | methyl 2-acetyloxy-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91589603 |
| Molecular Formula | C19H27FO11 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | methyl 2-acetyloxy-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(OC(C)=O)OC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)C(C)CC1F |
| InChI | InChI=1S/C19H27FO11/c1-9-7-15(20)19(18(25)26-6,30-13(5)24)31-16(9)17(29-12(4)23)14(28-11(3)22)8-27-10(2)21/h9,14-17H,7-8H2,1-6H3 |
| InChIKey | GOXWXLDFSKHUPK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|