C21H29FO13 — CID 90788373
methyl 2,4-diacetyloxy-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate (PubChem CID 90788373) has the molecular formula C21H29FO13 and a molecular weight of 508.45 g/mol. Its IUPAC name is methyl 2,4-diacetyloxy-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate.
| Compound Name | methyl 2,4-diacetyloxy-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 90788373 |
| Molecular Formula | C21H29FO13 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | methyl 2,4-diacetyloxy-3-fluoro-5-methyl-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(OC(C)=O)OC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)C(C)C(OC(C)=O)C1F |
| InChI | InChI=1S/C21H29FO13/c1-9-16(18(33-13(5)26)15(31-11(3)24)8-30-10(2)23)35-21(20(28)29-7,34-14(6)27)19(22)17(9)32-12(4)25/h9,15-19H,8H2,1-7H3 |
| InChIKey | QYHMTLVXXHRHAL-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|