C16H24F2O8 — CID 91162524
methyl 6-(2,3-diacetyloxy-1-methoxypropyl)-2,3-difluoro-5-methyloxane-2-carboxylate (PubChem CID 91162524) has the molecular formula C16H24F2O8 and a molecular weight of 382.36 g/mol. Its IUPAC name is methyl 6-(2,3-diacetyloxy-1-methoxypropyl)-2,3-difluoro-5-methyloxane-2-carboxylate.
| Compound Name | methyl 6-(2,3-diacetyloxy-1-methoxypropyl)-2,3-difluoro-5-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 91162524 |
| Molecular Formula | C16H24F2O8 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | methyl 6-(2,3-diacetyloxy-1-methoxypropyl)-2,3-difluoro-5-methyloxane-2-carboxylate |
| SMILES | COC(=O)C1(F)OC(C(OC)C(COC(C)=O)OC(C)=O)C(C)CC1F |
| InChI | InChI=1S/C16H24F2O8/c1-8-6-12(17)16(18,15(21)23-5)26-13(8)14(22-4)11(25-10(3)20)7-24-9(2)19/h8,11-14H,6-7H2,1-5H3 |
| InChIKey | CFPDAVUMUMLAMV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|