C18H27O9Y- — CID 58153211
methyl (3R,4S)-4-acetyloxy-2-[(1R,2R)-1,2-diacetyloxybutyl]-3-methyl-2,3,4,5-tetrahydropyran-6-ide-6-carboxylate;yttrium (PubChem CID 58153211) has the molecular formula C18H27O9Y- and a molecular weight of 476.31 g/mol. Its IUPAC name is methyl (3R,4S)-4-acetyloxy-2-[(1R,2R)-1,2-diacetyloxybutyl]-3-methyl-2,3,4,5-tetrahydropyran-6-ide-6-carboxylate;yttrium.
| Compound Name | methyl (3R,4S)-4-acetyloxy-2-[(1R,2R)-1,2-diacetyloxybutyl]-3-methyl-2,3,4,5-tetrahydropyran-6-ide-6-carboxylate;yttrium |
|---|---|
| PubChem CID | 58153211 |
| Molecular Formula | C18H27O9Y- |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | methyl (3R,4S)-4-acetyloxy-2-[(1R,2R)-1,2-diacetyloxybutyl]-3-methyl-2,3,4,5-tetrahydropyran-6-ide-6-carboxylate;yttrium |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1O[C-](C(=O)OC)C[C@H](OC(C)=O)[C@H]1C.[Y] |
| InChI | InChI=1S/C18H27O9.Y/c1-7-13(24-10(3)19)17(26-12(5)21)16-9(2)14(25-11(4)20)8-15(27-16)18(22)23-6;/h9,13-14,16-17H,7-8H2,1-6H3;/q-1;/t9-,13-,14+,16?,17-;/m1./s1 |
| InChIKey | IRRDXDHSSPUMCK-WLVUUWFUSA-N |
| XLogP | 1.32 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|