C21H30O13 — CID 134931792
diethyl 2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanedioate (PubChem CID 134931792) has the molecular formula C21H30O13 and a molecular weight of 490.46 g/mol. Its IUPAC name is diethyl 2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanedioate.
| Compound Name | diethyl 2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanedioate |
|---|---|
| PubChem CID | 134931792 |
| Molecular Formula | C21H30O13 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | diethyl 2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H30O13/c1-7-28-20(26)15(21(27)29-8-2)17-19(33-13(6)25)18(32-12(5)24)16(31-11(4)23)14(34-17)9-30-10(3)22/h14-19H,7-9H2,1-6H3/t14-,16-,17+,18+,19+/m1/s1 |
| InChIKey | ZXXOGFNBAHJXSI-IQRFUGTFSA-N |
| XLogP | -0.15 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|