C15H24O6 — CID 10661939
dimethyl 2-[(2R,3R,7R)-2,3-dimethyl-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate (PubChem CID 10661939) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is dimethyl 2-[(2R,3R,7R)-2,3-dimethyl-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R,3R,7R)-2,3-dimethyl-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate |
|---|---|
| PubChem CID | 10661939 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | dimethyl 2-[(2R,3R,7R)-2,3-dimethyl-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1CCCC2(C1)O[C@H](C)[C@@H](C)O2 |
| InChI | InChI=1S/C15H24O6/c1-9-10(2)21-15(20-9)7-5-6-11(8-15)12(13(16)18-3)14(17)19-4/h9-12H,5-8H2,1-4H3/t9-,10-,11-/m1/s1 |
| InChIKey | JZPGAXBGXURYAM-GMTAPVOTSA-N |
| XLogP | 1.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|