C13H20O6 — CID 67511089
dimethyl 2-(1,4-dioxaspiro[4.5]decan-7-yl)propanedioate (PubChem CID 67511089) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is dimethyl 2-(1,4-dioxaspiro[4.5]decan-7-yl)propanedioate.
| Compound Name | dimethyl 2-(1,4-dioxaspiro[4.5]decan-7-yl)propanedioate |
|---|---|
| PubChem CID | 67511089 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | dimethyl 2-(1,4-dioxaspiro[4.5]decan-7-yl)propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C13H20O6/c1-16-11(14)10(12(15)17-2)9-4-3-5-13(8-9)18-6-7-19-13/h9-10H,3-8H2,1-2H3 |
| InChIKey | CHGJOCTYTLQAEU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|