C15H26O4 — CID 85424235
tert-butyl 2-(1,4-dioxaspiro[4.5]decan-7-yl)propanoate (PubChem CID 85424235) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl 2-(1,4-dioxaspiro[4.5]decan-7-yl)propanoate.
| Compound Name | tert-butyl 2-(1,4-dioxaspiro[4.5]decan-7-yl)propanoate |
|---|---|
| PubChem CID | 85424235 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | tert-butyl 2-(1,4-dioxaspiro[4.5]decan-7-yl)propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)C1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C15H26O4/c1-11(13(16)19-14(2,3)4)12-6-5-7-15(10-12)17-8-9-18-15/h11-12H,5-10H2,1-4H3 |
| InChIKey | XXCFBXCIIKOFMP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |