C20H28N8O5S — CID 155456462
2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-propyl-7-[2-(sulfamoylamino)ethoxy]benzimidazole-5-carboxamide (PubChem CID 155456462) has the molecular formula C20H28N8O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-propyl-7-[2-(sulfamoylamino)ethoxy]benzimidazole-5-carboxamide.
| Compound Name | 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-propyl-7-[2-(sulfamoylamino)ethoxy]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155456462 |
| Molecular Formula | C20H28N8O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-propyl-7-[2-(sulfamoylamino)ethoxy]benzimidazole-5-carboxamide |
| SMILES | CCCn1c(NC(=O)c2cc(C)nn2CC)nc2cc(C(N)=O)cc(OCCNS(N)(=O)=O)c21 |
| InChI | InChI=1S/C20H28N8O5S/c1-4-7-27-17-14(24-20(27)25-19(30)15-9-12(3)26-28(15)5-2)10-13(18(21)29)11-16(17)33-8-6-23-34(22,31)32/h9-11,23H,4-8H2,1-3H3,(H2,21,29)(H2,22,31,32)(H,24,25,30) |
| InChIKey | TWCQWNSKIZZOOW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 189.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|