C46H36N2O6 — CID 155460071
(E)-4-[4-[1-[4-[[(E)-3-carboxyprop-2-enoyl]amino]-3-phenylphenyl]-1-(4-phenylphenyl)ethyl]-2-phenylanilino]-4-oxobut-2-enoic acid (PubChem CID 155460071) has the molecular formula C46H36N2O6 and a molecular weight of 712.80 g/mol. Its IUPAC name is (E)-4-[4-[1-[4-[[(E)-3-carboxyprop-2-enoyl]amino]-3-phenylphenyl]-1-(4-phenylphenyl)ethyl]-2-phenylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[1-[4-[[(E)-3-carboxyprop-2-enoyl]amino]-3-phenylphenyl]-1-(4-phenylphenyl)ethyl]-2-phenylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 155460071 |
| Molecular Formula | C46H36N2O6 |
| Molecular Weight | 712.80 g/mol |
| Exact Mass | 712.26 |
| IUPAC Name | (E)-4-[4-[1-[4-[[(E)-3-carboxyprop-2-enoyl]amino]-3-phenylphenyl]-1-(4-phenylphenyl)ethyl]-2-phenylanilino]-4-oxobut-2-enoic acid |
| SMILES | CC(c1ccc(-c2ccccc2)cc1)(c1ccc(NC(=O)/C=C/C(=O)O)c(-c2ccccc2)c1)c1ccc(NC(=O)/C=C/C(=O)O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C46H36N2O6/c1-46(35-19-17-32(18-20-35)31-11-5-2-6-12-31,36-21-23-40(47-42(49)25-27-44(51)52)38(29-36)33-13-7-3-8-14-33)37-22-24-41(48-43(50)26-28-45(53)54)39(30-37)34-15-9-4-10-16-34/h2-30H,1H3,(H,47,49)(H,48,50)(H,51,52)(H,53,54)/b27-25+,28-26+ |
| InChIKey | DRFBDYHHPKKTTN-NBHCHVEOSA-N |
| XLogP | 9.20 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.80 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|