C31H30N2O6 — CID 155460086
(E)-4-[4-[(4-butan-2-ylphenyl)-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]methyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 155460086) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is (E)-4-[4-[(4-butan-2-ylphenyl)-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]methyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[(4-butan-2-ylphenyl)-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]methyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 155460086 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (E)-4-[4-[(4-butan-2-ylphenyl)-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]methyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | CCC(C)c1ccc(C(c2ccc(NC(=O)/C=C/C(=O)O)cc2)c2ccc(NC(=O)/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O6/c1-3-20(2)21-4-6-22(7-5-21)31(23-8-12-25(13-9-23)32-27(34)16-18-29(36)37)24-10-14-26(15-11-24)33-28(35)17-19-30(38)39/h4-20,31H,3H2,1-2H3,(H,32,34)(H,33,35)(H,36,37)(H,38,39)/b18-16+,19-17+ |
| InChIKey | RSCFOKNGGBXAPG-YWNVXTCZSA-N |
| XLogP | 5.54 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|