C18H24N2O4 — CID 155461185
methyl 2-(ethoxymethyl)-1-(2-hydroxy-2-methylpropyl)-5-phenylimidazole-4-carboxylate (PubChem CID 155461185) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 2-(ethoxymethyl)-1-(2-hydroxy-2-methylpropyl)-5-phenylimidazole-4-carboxylate.
| Compound Name | methyl 2-(ethoxymethyl)-1-(2-hydroxy-2-methylpropyl)-5-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 155461185 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl 2-(ethoxymethyl)-1-(2-hydroxy-2-methylpropyl)-5-phenylimidazole-4-carboxylate |
| SMILES | CCOCc1nc(C(=O)OC)c(-c2ccccc2)n1CC(C)(C)O |
| InChI | InChI=1S/C18H24N2O4/c1-5-24-11-14-19-15(17(21)23-4)16(13-9-7-6-8-10-13)20(14)12-18(2,3)22/h6-10,22H,5,11-12H2,1-4H3 |
| InChIKey | YRYUNWJHYZVRFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |