C70H54N4 — CID 155462612
9-[2-(2-carbazol-9-ylphenyl)-5-(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-bis(2,4,6-trimethylphenyl)carbazole (PubChem CID 155462612) has the molecular formula C70H54N4 and a molecular weight of 951.23 g/mol. Its IUPAC name is 9-[2-(2-carbazol-9-ylphenyl)-5-(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-bis(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 9-[2-(2-carbazol-9-ylphenyl)-5-(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-bis(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 155462612 |
| Molecular Formula | C70H54N4 |
| Molecular Weight | 951.23 g/mol |
| Exact Mass | 950.43 |
| IUPAC Name | 9-[2-(2-carbazol-9-ylphenyl)-5-(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-bis(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2cc(-c4c(C)cc(C)cc4C)ccc2n3-c2cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)ccc2-c2ccccc2-n2c3ccccc3c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C70H54N4/c1-43-35-45(3)68(46(4)36-43)51-30-33-65-58(39-51)59-40-52(69-47(5)37-44(2)38-48(69)6)31-34-66(59)74(65)67-41-53(70-71-60(49-19-9-7-10-20-49)42-61(72-70)50-21-11-8-12-22-50)29-32-57(67)56-25-15-18-28-64(56)73-62-26-16-13-23-54(62)55-24-14-17-27-63(55)73/h7-42H,1-6H3 |
| InChIKey | HCSKHAVFZHEFPP-UHFFFAOYSA-N |
| XLogP | 18.52 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.23 |
| LogP ≤ 5 | 18.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |