C8H5BrClN3O — CID 155463570
5-bromo-8-chloro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 155463570) has the molecular formula C8H5BrClN3O and a molecular weight of 274.50 g/mol. Its IUPAC name is 5-bromo-8-chloro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 5-bromo-8-chloro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155463570 |
| Molecular Formula | C8H5BrClN3O |
| Molecular Weight | 274.50 g/mol |
| Exact Mass | 272.93 |
| IUPAC Name | 5-bromo-8-chloro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(Cl)ncc(Br)c2c(=O)[nH]1 |
| InChI | InChI=1S/C8H5BrClN3O/c1-3-12-6-5(8(14)13-3)4(9)2-11-7(6)10/h2H,1H3,(H,12,13,14) |
| InChIKey | PQYWBLNHBBFVEP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|