About 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate
2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate (PubChem CID 155465292) has the molecular formula C7H16N2S
and a molecular weight of 160.29 g/mol. Its IUPAC name is 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate.
Molecular Properties
| Compound Name | 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate |
| PubChem CID | 155465292 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate |
| SMILES | CCC(S/C=N\N)C(C)C |
| InChI | InChI=1S/C7H16N2S/c1-4-7(6(2)3)10-5-9-8/h5-7H,4,8H2,1-3H3/b9-5- |
| InChIKey | SEQVREHNLDPIAB-UITAMQMPSA-N |
| XLogP | 2.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate?
The IUPAC name of 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate (CID 155465292) is 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate.
What is the SMILES notation for 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate?
The canonical SMILES for 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate is CCC(S/C=N\N)C(C)C.
What is the InChIKey of 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate?
The InChIKey is SEQVREHNLDPIAB-UITAMQMPSA-N. The full InChI is InChI=1S/C7H16N2S/c1-4-7(6(2)3)10-5-9-8/h5-7H,4,8H2,1-3H3/b9-5-.
What are the key properties of 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate?
2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate has a molecular weight of 160.29 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentan-3-yl (1Z)-N-aminomethanimidothioate is sourced from PubChem (CID 155465292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).