C23H28FN5OS — CID 155466655
(Z)-2-[amino-[[3-[4-[4-(1,3-dimethylazetidin-3-yl)sulfanylphenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]ethenamine (PubChem CID 155466655) has the molecular formula C23H28FN5OS and a molecular weight of 441.58 g/mol. Its IUPAC name is (Z)-2-[amino-[[3-[4-[4-(1,3-dimethylazetidin-3-yl)sulfanylphenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]ethenamine.
| Compound Name | (Z)-2-[amino-[[3-[4-[4-(1,3-dimethylazetidin-3-yl)sulfanylphenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]ethenamine |
|---|---|
| PubChem CID | 155466655 |
| Molecular Formula | C23H28FN5OS |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (Z)-2-[amino-[[3-[4-[4-(1,3-dimethylazetidin-3-yl)sulfanylphenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]ethenamine |
| SMILES | CN1CC(C)(Sc2ccc(-c3ccc(C4=NOC(CN(N)/C=C\N)C4)cc3F)cc2)C1 |
| InChI | InChI=1S/C23H28FN5OS/c1-23(14-28(2)15-23)31-19-6-3-16(4-7-19)20-8-5-17(11-21(20)24)22-12-18(30-27-22)13-29(26)10-9-25/h3-11,18H,12-15,25-26H2,1-2H3/b10-9- |
| InChIKey | MHRIRLYBQGTVJU-KTKRTIGZSA-N |
| XLogP | 3.39 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|