C22H24FN3O3S — CID 134591173
N-[2-[3-[3-fluoro-4-[4-(2-nitrosopropan-2-yl)phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-1-methylsulfanylethyl]formamide (PubChem CID 134591173) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-[3-[3-fluoro-4-[4-(2-nitrosopropan-2-yl)phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-1-methylsulfanylethyl]formamide.
| Compound Name | N-[2-[3-[3-fluoro-4-[4-(2-nitrosopropan-2-yl)phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-1-methylsulfanylethyl]formamide |
|---|---|
| PubChem CID | 134591173 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[2-[3-[3-fluoro-4-[4-(2-nitrosopropan-2-yl)phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-1-methylsulfanylethyl]formamide |
| SMILES | CSC(CC1CC(c2ccc(-c3ccc(C(C)(C)N=O)cc3)c(F)c2)=NO1)NC=O |
| InChI | InChI=1S/C22H24FN3O3S/c1-22(2,26-28)16-7-4-14(5-8-16)18-9-6-15(10-19(18)23)20-11-17(29-25-20)12-21(30-3)24-13-27/h4-10,13,17,21H,11-12H2,1-3H3,(H,24,27) |
| InChIKey | MHOJURLFIORRJW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|