C71H81N — CID 155467234
N-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethyl-N-[4-[4-(2,4,6-tricyclohexylphenyl)phenyl]phenyl]fluoren-2-amine (PubChem CID 155467234) has the molecular formula C71H81N and a molecular weight of 948.44 g/mol. Its IUPAC name is N-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethyl-N-[4-[4-(2,4,6-tricyclohexylphenyl)phenyl]phenyl]fluoren-2-amine.
| Compound Name | N-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethyl-N-[4-[4-(2,4,6-tricyclohexylphenyl)phenyl]phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 155467234 |
| Molecular Formula | C71H81N |
| Molecular Weight | 948.44 g/mol |
| Exact Mass | 947.64 |
| IUPAC Name | N-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethyl-N-[4-[4-(2,4,6-tricyclohexylphenyl)phenyl]phenyl]fluoren-2-amine |
| SMILES | CC(C)(C)c1cc(-c2ccc(N(c3ccc(-c4ccc(-c5c(C6CCCCC6)cc(C6CCCCC6)cc5C5CCCCC5)cc4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C71H81N/c1-69(2,3)57-42-55(43-58(46-57)70(4,5)6)51-34-38-60(39-35-51)72(61-40-41-63-62-26-18-19-27-66(62)71(7,8)67(63)47-61)59-36-32-50(33-37-59)49-28-30-54(31-29-49)68-64(52-22-14-10-15-23-52)44-56(48-20-12-9-13-21-48)45-65(68)53-24-16-11-17-25-53/h18-19,26-48,52-53H,9-17,20-25H2,1-8H3 |
| InChIKey | VFLUMQMXGCFTMB-UHFFFAOYSA-N |
| XLogP | 21.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.44 |
| LogP ≤ 5 | 21.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |