C25H28N6O3 — CID 155469284
N-hydroxy-2-[[4-(2-methylphenyl)-1-[methyl(phenyl)carbamoyl]piperidin-4-yl]amino]pyrimidine-5-carboxamide (PubChem CID 155469284) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is N-hydroxy-2-[[4-(2-methylphenyl)-1-[methyl(phenyl)carbamoyl]piperidin-4-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[[4-(2-methylphenyl)-1-[methyl(phenyl)carbamoyl]piperidin-4-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155469284 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-hydroxy-2-[[4-(2-methylphenyl)-1-[methyl(phenyl)carbamoyl]piperidin-4-yl]amino]pyrimidine-5-carboxamide |
| SMILES | Cc1ccccc1C1(Nc2ncc(C(=O)NO)cn2)CCN(C(=O)N(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N6O3/c1-18-8-6-7-11-21(18)25(28-23-26-16-19(17-27-23)22(32)29-34)12-14-31(15-13-25)24(33)30(2)20-9-4-3-5-10-20/h3-11,16-17,34H,12-15H2,1-2H3,(H,29,32)(H,26,27,28) |
| InChIKey | DQZOSPASLAHQTA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|